| Name | Calcium glycinate |
| Synonyms | Glycine calcium CalClum Glycinate Calcium glycinate Calcium Methionine Bisglycinatocalcium Diglycine calcium salt |
| CAS | 35947-07-0 |
| EINECS | 252-809-5 |
| InChI | InChI=1/C2H5NO2.Ca/c3-1-2(4)5;/h1,3H2,(H,4,5);/q;+2 |
| Molecular Formula | C2H7CaNO2 |
| Molar Mass | 117.16 |
| Density | 1629[at 20℃] |
| Boling Point | 240.9°C at 760 mmHg |
| Flash Point | 99.5°C |
| Water Solubility | 580.12g/L at 20℃ |
| Vapor Presure | 0Pa at 20℃ |
| Storage Condition | Room Temprature |
| Physical and Chemical Properties | White Flake or granular powder, soluble in water, difficult to dissolve in ethanol, sweet taste. |
| Use | New calcium supplements, more easily absorbed by the body than other calcium supplements |
| LogP | -3.65 at 20℃ |
| Application | Calcium glycinate has a stable chemical structure and is not affected by gastric acid, oxalic acid, etc., and can be completely absorbed by the body. After absorption, calcium can be directly transported to specific target tissues and enzyme systems, which greatly improves the biological utilization rate of calcium, increases calcium deposition, and enhances bone density, it has found a new shortcut for osteoporosis patients and has been widely used in food, medicine and health care products industries. |
| use | the new calcium supplement is more easily absorbed by the human body than other calcium supplements as a new calcium supplement, it is more easily absorbed by the human body than other calcium supplements |